C14H12N4O2S — CID 63577775
4-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]benzohydrazide (PubChem CID 63577775) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]benzohydrazide.
| Compound Name | 4-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 63577775 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc(Cn2cnc3ccsc3c2=O)cc1 |
| InChI | InChI=1S/C14H12N4O2S/c15-17-13(19)10-3-1-9(2-4-10)7-18-8-16-11-5-6-21-12(11)14(18)20/h1-6,8H,7,15H2,(H,17,19) |
| InChIKey | LYTRJLASIKRFSJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|