C10H20N4O2 — CID 63577874
1-(1-hydrazinyl-1-oxobutan-2-yl)-N-methylpyrrolidine-2-carboxamide (PubChem CID 63577874) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1-(1-hydrazinyl-1-oxobutan-2-yl)-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-(1-hydrazinyl-1-oxobutan-2-yl)-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 63577874 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-(1-hydrazinyl-1-oxobutan-2-yl)-N-methylpyrrolidine-2-carboxamide |
| SMILES | CCC(C(=O)NN)N1CCCC1C(=O)NC |
| InChI | InChI=1S/C10H20N4O2/c1-3-7(10(16)13-11)14-6-4-5-8(14)9(15)12-2/h7-8H,3-6,11H2,1-2H3,(H,12,15)(H,13,16) |
| InChIKey | MPYFTWXXHQIJIF-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|