About 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide
3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide (PubChem CID 63577972) has the molecular formula C8H8N6O4
and a molecular weight of 252.19 g/mol. Its IUPAC name is 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide |
| PubChem CID | 63577972 |
| Molecular Formula | C8H8N6O4 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide |
| SMILES | NNC(=O)c1occc1Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H8N6O4/c9-11-7(15)6-5(1-2-18-6)3-13-4-10-8(12-13)14(16)17/h1-2,4H,3,9H2,(H,11,15) |
| InChIKey | UJCMBZMHUCQVOV-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide?
The IUPAC name of 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide (CID 63577972) is 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide.
What is the SMILES notation for 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide?
The canonical SMILES for 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide is NNC(=O)c1occc1Cn1cnc([N+](=O)[O-])n1.
What is the InChIKey of 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide?
The InChIKey is UJCMBZMHUCQVOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6O4/c9-11-7(15)6-5(1-2-18-6)3-13-4-10-8(12-13)14(16)17/h1-2,4H,3,9H2,(H,11,15).
What are the key properties of 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide?
3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide has a molecular weight of 252.19 g/mol, XLogP of -0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]furan-2-carbohydrazide is sourced from PubChem (CID 63577972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).