About 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide
3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide (PubChem CID 63578019) has the molecular formula C15H20N4OS
and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide |
| PubChem CID | 63578019 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sc2ccccc2c1CN1CCCNCC1 |
| InChI | InChI=1S/C15H20N4OS/c16-18-15(20)14-12(10-19-8-3-6-17-7-9-19)11-4-1-2-5-13(11)21-14/h1-2,4-5,17H,3,6-10,16H2,(H,18,20) |
| InChIKey | MKYFGPKUUSPWQJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide?
The IUPAC name of 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide (CID 63578019) is 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide.
What is the SMILES notation for 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide?
The canonical SMILES for 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide is NNC(=O)c1sc2ccccc2c1CN1CCCNCC1.
What is the InChIKey of 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide?
The InChIKey is MKYFGPKUUSPWQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4OS/c16-18-15(20)14-12(10-19-8-3-6-17-7-9-19)11-4-1-2-5-13(11)21-14/h1-2,4-5,17H,3,6-10,16H2,(H,18,20).
What are the key properties of 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide?
3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide has a molecular weight of 304.42 g/mol, XLogP of 1.30, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carbohydrazide is sourced from PubChem (CID 63578019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).