C10H23N3O — CID 63578194
3-[2,2-dimethylpropyl(methyl)amino]butanehydrazide (PubChem CID 63578194) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[2,2-dimethylpropyl(methyl)amino]butanehydrazide.
| Compound Name | 3-[2,2-dimethylpropyl(methyl)amino]butanehydrazide |
|---|---|
| PubChem CID | 63578194 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 3-[2,2-dimethylpropyl(methyl)amino]butanehydrazide |
| SMILES | CC(CC(=O)NN)N(C)CC(C)(C)C |
| InChI | InChI=1S/C10H23N3O/c1-8(6-9(14)12-11)13(5)7-10(2,3)4/h8H,6-7,11H2,1-5H3,(H,12,14) |
| InChIKey | SXMADVTYHFYZDB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|