C24H30FNO2 — CID 6357852
(1S,4aR,8aR)-1-(2-ethoxyphenyl)-2-[(3-fluorophenyl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 6357852) has the molecular formula C24H30FNO2 and a molecular weight of 383.51 g/mol. Its IUPAC name is (1S,4aR,8aR)-1-(2-ethoxyphenyl)-2-[(3-fluorophenyl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | (1S,4aR,8aR)-1-(2-ethoxyphenyl)-2-[(3-fluorophenyl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 6357852 |
| Molecular Formula | C24H30FNO2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (1S,4aR,8aR)-1-(2-ethoxyphenyl)-2-[(3-fluorophenyl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CCOc1ccccc1[C@@H]1[C@H]2CCCC[C@@]2(O)CCN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H30FNO2/c1-2-28-22-12-4-3-10-20(22)23-21-11-5-6-13-24(21,27)14-15-26(23)17-18-8-7-9-19(25)16-18/h3-4,7-10,12,16,21,23,27H,2,5-6,11,13-15,17H2,1H3/t21-,23-,24-/m1/s1 |
| InChIKey | UCEGOWGVZLOCAE-GMKZXUHWSA-N |
| XLogP | 5.09 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |