C12H16N4O4 — CID 63578611
2-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]furan-3-carbohydrazide (PubChem CID 63578611) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]furan-3-carbohydrazide.
| Compound Name | 2-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63578611 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]furan-3-carbohydrazide |
| SMILES | CCCC1NC(=O)N(Cc2occc2C(=O)NN)C1=O |
| InChI | InChI=1S/C12H16N4O4/c1-2-3-8-11(18)16(12(19)14-8)6-9-7(4-5-20-9)10(17)15-13/h4-5,8H,2-3,6,13H2,1H3,(H,14,19)(H,15,17) |
| InChIKey | LRHKRZFYTPDZMJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|