C12H14N4O4 — CID 63578730
5-[(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)methyl]furan-2-carbohydrazide (PubChem CID 63578730) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)methyl]furan-2-carbohydrazide.
| Compound Name | 5-[(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63578730 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-[(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)methyl]furan-2-carbohydrazide |
| SMILES | Cc1c(C)c(=O)n(Cc2ccc(C(=O)NN)o2)[nH]c1=O |
| InChI | InChI=1S/C12H14N4O4/c1-6-7(2)12(19)16(15-10(6)17)5-8-3-4-9(20-8)11(18)14-13/h3-4H,5,13H2,1-2H3,(H,14,18)(H,15,17) |
| InChIKey | OQHGKFZTEWUYJD-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|