About 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide
2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide (PubChem CID 63578895) has the molecular formula C8H12N4O3
and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide |
| PubChem CID | 63578895 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide |
| SMILES | Cc1c(C)c(=O)n(CC(=O)NN)[nH]c1=O |
| InChI | InChI=1S/C8H12N4O3/c1-4-5(2)8(15)12(11-7(4)14)3-6(13)10-9/h3,9H2,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | CKJRREBYDNJDBP-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide?
The IUPAC name of 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide (CID 63578895) is 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide.
What is the SMILES notation for 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide?
The canonical SMILES for 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide is Cc1c(C)c(=O)n(CC(=O)NN)[nH]c1=O.
What is the InChIKey of 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide?
The InChIKey is CKJRREBYDNJDBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3/c1-4-5(2)8(15)12(11-7(4)14)3-6(13)10-9/h3,9H2,1-2H3,(H,10,13)(H,11,14).
What are the key properties of 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide?
2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide has a molecular weight of 212.21 g/mol, XLogP of -1.86, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)acetohydrazide is sourced from PubChem (CID 63578895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).