C9H8FN5O3S — CID 63579073
4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63579073) has the molecular formula C9H8FN5O3S and a molecular weight of 285.26 g/mol. Its IUPAC name is 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63579073 |
| Molecular Formula | C9H8FN5O3S |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(Cn2cc(F)c(=O)[nH]c2=O)cs1 |
| InChI | InChI=1S/C9H8FN5O3S/c10-5-2-15(9(18)13-6(5)16)1-4-3-19-8(12-4)7(17)14-11/h2-3H,1,11H2,(H,14,17)(H,13,16,18) |
| InChIKey | WYRQTPHNNMLKHX-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|