C9H11N5O2 — CID 63579229
5-[(4-methylpyrazol-1-yl)methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63579229) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 5-[(4-methylpyrazol-1-yl)methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(4-methylpyrazol-1-yl)methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63579229 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 5-[(4-methylpyrazol-1-yl)methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | Cc1cnn(Cc2cc(C(=O)NN)no2)c1 |
| InChI | InChI=1S/C9H11N5O2/c1-6-3-11-14(4-6)5-7-2-8(13-16-7)9(15)12-10/h2-4H,5,10H2,1H3,(H,12,15) |
| InChIKey | TYROVDPZGZZPQO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|