About 2-bromopropane
2-bromopropane (PubChem CID 6358) has the molecular formula C3H7Br
and a molecular weight of 122.99 g/mol. Its IUPAC name is 2-bromopropane.
Molecular Properties
| Compound Name | 2-bromopropane |
| PubChem CID | 6358 |
| Molecular Formula | C3H7Br |
| Molecular Weight | 122.99 g/mol |
| Exact Mass | 121.97 |
| IUPAC Name | 2-bromopropane |
| SMILES | CC(C)Br |
| InChI | InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3 |
| InChIKey | NAMYKGVDVNBCFQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.99 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopropane?
The IUPAC name of 2-bromopropane (CID 6358) is 2-bromopropane.
What is the SMILES notation for 2-bromopropane?
The canonical SMILES for 2-bromopropane is CC(C)Br.
What is the InChIKey of 2-bromopropane?
The InChIKey is NAMYKGVDVNBCFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3.
What are the key properties of 2-bromopropane?
2-bromopropane has a molecular weight of 122.99 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopropane is sourced from PubChem (CID 6358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).