About 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide
2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide (PubChem CID 63580014) has the molecular formula C6H8N6O
and a molecular weight of 180.17 g/mol. Its IUPAC name is 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide.
Molecular Properties
| Compound Name | 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide |
| PubChem CID | 63580014 |
| Molecular Formula | C6H8N6O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide |
| SMILES | CC(C(=O)NN)n1cnc(C#N)n1 |
| InChI | InChI=1S/C6H8N6O/c1-4(6(13)10-8)12-3-9-5(2-7)11-12/h3-4H,8H2,1H3,(H,10,13) |
| InChIKey | CWZPNFFGLZYXFC-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide?
The IUPAC name of 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide (CID 63580014) is 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide.
What is the SMILES notation for 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide?
The canonical SMILES for 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide is CC(C(=O)NN)n1cnc(C#N)n1.
What is the InChIKey of 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide?
The InChIKey is CWZPNFFGLZYXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N6O/c1-4(6(13)10-8)12-3-9-5(2-7)11-12/h3-4H,8H2,1H3,(H,10,13).
What are the key properties of 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide?
2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide has a molecular weight of 180.17 g/mol, XLogP of -1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyano-1,2,4-triazol-1-yl)propanehydrazide is sourced from PubChem (CID 63580014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).