C10H15N7O2S — CID 63581050
5-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63581050) has the molecular formula C10H15N7O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 5-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63581050 |
| Molecular Formula | C10H15N7O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | CC(C)n1c(N)nnc1SCc1cc(C(=O)NN)no1 |
| InChI | InChI=1S/C10H15N7O2S/c1-5(2)17-9(11)14-15-10(17)20-4-6-3-7(16-19-6)8(18)13-12/h3,5H,4,12H2,1-2H3,(H2,11,14)(H,13,18) |
| InChIKey | VNRDGKDTAAFJIB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 137.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|