C9H15N5O3S — CID 63581238
5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanylmethyl]oxolane-2-carbohydrazide (PubChem CID 63581238) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanylmethyl]oxolane-2-carbohydrazide.
| Compound Name | 5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanylmethyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 63581238 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanylmethyl]oxolane-2-carbohydrazide |
| SMILES | Cn1c(SCC2CCC(C(=O)NN)O2)n[nH]c1=O |
| InChI | InChI=1S/C9H15N5O3S/c1-14-8(16)12-13-9(14)18-4-5-2-3-6(17-5)7(15)11-10/h5-6H,2-4,10H2,1H3,(H,11,15)(H,12,16) |
| InChIKey | GPGHTRZFGDUXEV-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|