About 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide
4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide (PubChem CID 63581497) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide.
Molecular Properties
| Compound Name | 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide |
| PubChem CID | 63581497 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide |
| SMILES | Cc1cc(C)c2c(c1)N(CCCC(=O)NN)C(=O)C2=O |
| InChI | InChI=1S/C14H17N3O3/c1-8-6-9(2)12-10(7-8)17(14(20)13(12)19)5-3-4-11(18)16-15/h6-7H,3-5,15H2,1-2H3,(H,16,18) |
| InChIKey | HSFJDROCCCGJNI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide?
The IUPAC name of 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide (CID 63581497) is 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide.
What is the SMILES notation for 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide?
The canonical SMILES for 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide is Cc1cc(C)c2c(c1)N(CCCC(=O)NN)C(=O)C2=O.
What is the InChIKey of 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide?
The InChIKey is HSFJDROCCCGJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-8-6-9(2)12-10(7-8)17(14(20)13(12)19)5-3-4-11(18)16-15/h6-7H,3-5,15H2,1-2H3,(H,16,18).
What are the key properties of 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide?
4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide has a molecular weight of 275.31 g/mol, XLogP of 0.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-dimethyl-2,3-dioxoindol-1-yl)butanehydrazide is sourced from PubChem (CID 63581497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).