About 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide
2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide (PubChem CID 63581538) has the molecular formula C8H8N4O2S2
and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide.
Molecular Properties
| Compound Name | 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide |
| PubChem CID | 63581538 |
| Molecular Formula | C8H8N4O2S2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide |
| SMILES | NNC(=O)c1ccoc1CSc1nncs1 |
| InChI | InChI=1S/C8H8N4O2S2/c9-11-7(13)5-1-2-14-6(5)3-15-8-12-10-4-16-8/h1-2,4H,3,9H2,(H,11,13) |
| InChIKey | OIFGJLWQUHTTGS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide?
The IUPAC name of 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide (CID 63581538) is 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide.
What is the SMILES notation for 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide?
The canonical SMILES for 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide is NNC(=O)c1ccoc1CSc1nncs1.
What is the InChIKey of 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide?
The InChIKey is OIFGJLWQUHTTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2S2/c9-11-7(13)5-1-2-14-6(5)3-15-8-12-10-4-16-8/h1-2,4H,3,9H2,(H,11,13).
What are the key properties of 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide?
2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide has a molecular weight of 256.31 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,4-thiadiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide is sourced from PubChem (CID 63581538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).