C11H15N5O3S — CID 63581804
5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carbohydrazide (PubChem CID 63581804) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carbohydrazide.
| Compound Name | 5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63581804 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carbohydrazide |
| SMILES | CCCn1c(SCc2ccc(C(=O)NN)o2)n[nH]c1=O |
| InChI | InChI=1S/C11H15N5O3S/c1-2-5-16-10(18)14-15-11(16)20-6-7-3-4-8(19-7)9(17)13-12/h3-4H,2,5-6,12H2,1H3,(H,13,17)(H,14,18) |
| InChIKey | APGUJXNSHWXVLN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|