About 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide
3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide (PubChem CID 63582668) has the molecular formula C6H10N4OS2
and a molecular weight of 218.31 g/mol. Its IUPAC name is 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide.
Molecular Properties
| Compound Name | 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide |
| PubChem CID | 63582668 |
| Molecular Formula | C6H10N4OS2 |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide |
| SMILES | CC(CC(=O)NN)Sc1nncs1 |
| InChI | InChI=1S/C6H10N4OS2/c1-4(2-5(11)9-7)13-6-10-8-3-12-6/h3-4H,2,7H2,1H3,(H,9,11) |
| InChIKey | ILUQACBASVPHRW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide?
The IUPAC name of 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide (CID 63582668) is 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide.
What is the SMILES notation for 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide?
The canonical SMILES for 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide is CC(CC(=O)NN)Sc1nncs1.
What is the InChIKey of 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide?
The InChIKey is ILUQACBASVPHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4OS2/c1-4(2-5(11)9-7)13-6-10-8-3-12-6/h3-4H,2,7H2,1H3,(H,9,11).
What are the key properties of 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide?
3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide has a molecular weight of 218.31 g/mol, XLogP of 0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanehydrazide is sourced from PubChem (CID 63582668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).