About 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide
5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide (PubChem CID 63582880) has the molecular formula C12H14F2N2O2S
and a molecular weight of 288.32 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide |
| PubChem CID | 63582880 |
| Molecular Formula | C12H14F2N2O2S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide |
| SMILES | NNC(=O)C1CCC(CSc2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C12H14F2N2O2S/c13-9-3-2-8(5-10(9)14)19-6-7-1-4-11(18-7)12(17)16-15/h2-3,5,7,11H,1,4,6,15H2,(H,16,17) |
| InChIKey | KENPLIXBSQYQTP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide?
The IUPAC name of 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide (CID 63582880) is 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide.
What is the SMILES notation for 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide?
The canonical SMILES for 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide is NNC(=O)C1CCC(CSc2ccc(F)c(F)c2)O1.
What is the InChIKey of 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide?
The InChIKey is KENPLIXBSQYQTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O2S/c13-9-3-2-8(5-10(9)14)19-6-7-1-4-11(18-7)12(17)16-15/h2-3,5,7,11H,1,4,6,15H2,(H,16,17).
What are the key properties of 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide?
5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide has a molecular weight of 288.32 g/mol, XLogP of 1.59, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carbohydrazide is sourced from PubChem (CID 63582880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).