C13H16N4OS2 — CID 63583083
4-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63583083) has the molecular formula C13H16N4OS2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63583083 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(CN(Cc2ccsc2)C2CC2)cs1 |
| InChI | InChI=1S/C13H16N4OS2/c14-16-12(18)13-15-10(8-20-13)6-17(11-1-2-11)5-9-3-4-19-7-9/h3-4,7-8,11H,1-2,5-6,14H2,(H,16,18) |
| InChIKey | PXSGXPCGMYKRCE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|