C11H16N4O3 — CID 63583335
2-[(5-oxo-1,4-diazepan-1-yl)methyl]furan-3-carbohydrazide (PubChem CID 63583335) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(5-oxo-1,4-diazepan-1-yl)methyl]furan-3-carbohydrazide.
| Compound Name | 2-[(5-oxo-1,4-diazepan-1-yl)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63583335 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-[(5-oxo-1,4-diazepan-1-yl)methyl]furan-3-carbohydrazide |
| SMILES | NNC(=O)c1ccoc1CN1CCNC(=O)CC1 |
| InChI | InChI=1S/C11H16N4O3/c12-14-11(17)8-2-6-18-9(8)7-15-4-1-10(16)13-3-5-15/h2,6H,1,3-5,7,12H2,(H,13,16)(H,14,17) |
| InChIKey | XWDOTIDOLQHXNC-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|