C9H13F3N4O2 — CID 63583927
5-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63583927) has the molecular formula C9H13F3N4O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 5-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63583927 |
| Molecular Formula | C9H13F3N4O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 5-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | CCN(Cc1cc(C(=O)NN)no1)CC(F)(F)F |
| InChI | InChI=1S/C9H13F3N4O2/c1-2-16(5-9(10,11)12)4-6-3-7(15-18-6)8(17)14-13/h3H,2,4-5,13H2,1H3,(H,14,17) |
| InChIKey | DGPVUSOKAUMZPW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|