About 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide
2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide (PubChem CID 63584109) has the molecular formula C9H18F3N3O
and a molecular weight of 241.26 g/mol. Its IUPAC name is 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide.
Molecular Properties
| Compound Name | 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide |
| PubChem CID | 63584109 |
| Molecular Formula | C9H18F3N3O |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide |
| SMILES | CCC(C(=O)NN)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H18F3N3O/c1-4-7(8(16)14-13)15(6(2)3)5-9(10,11)12/h6-7H,4-5,13H2,1-3H3,(H,14,16) |
| InChIKey | UQCHWQHEVJTICU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide?
The IUPAC name of 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide (CID 63584109) is 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide.
What is the SMILES notation for 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide?
The canonical SMILES for 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide is CCC(C(=O)NN)N(CC(F)(F)F)C(C)C.
What is the InChIKey of 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide?
The InChIKey is UQCHWQHEVJTICU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3N3O/c1-4-7(8(16)14-13)15(6(2)3)5-9(10,11)12/h6-7H,4-5,13H2,1-3H3,(H,14,16).
What are the key properties of 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide?
2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide has a molecular weight of 241.26 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanehydrazide is sourced from PubChem (CID 63584109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).