C8H16F3N3O — CID 63584111
3-[ethyl(2,2,2-trifluoroethyl)amino]butanehydrazide (PubChem CID 63584111) has the molecular formula C8H16F3N3O and a molecular weight of 227.23 g/mol. Its IUPAC name is 3-[ethyl(2,2,2-trifluoroethyl)amino]butanehydrazide.
| Compound Name | 3-[ethyl(2,2,2-trifluoroethyl)amino]butanehydrazide |
|---|---|
| PubChem CID | 63584111 |
| Molecular Formula | C8H16F3N3O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-[ethyl(2,2,2-trifluoroethyl)amino]butanehydrazide |
| SMILES | CCN(CC(F)(F)F)C(C)CC(=O)NN |
| InChI | InChI=1S/C8H16F3N3O/c1-3-14(5-8(9,10)11)6(2)4-7(15)13-12/h6H,3-5,12H2,1-2H3,(H,13,15) |
| InChIKey | BHLCUNCXDCNOIP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|