C11H16F3N5O2 — CID 63585010
5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63585010) has the molecular formula C11H16F3N5O2 and a molecular weight of 307.28 g/mol. Its IUPAC name is 5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63585010 |
| Molecular Formula | C11H16F3N5O2 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | NNC(=O)c1cc(CN2CCN(CC(F)(F)F)CC2)on1 |
| InChI | InChI=1S/C11H16F3N5O2/c12-11(13,14)7-19-3-1-18(2-4-19)6-8-5-9(17-21-8)10(20)16-15/h5H,1-4,6-7,15H2,(H,16,20) |
| InChIKey | GRZZLOCXDRPQNW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|