About ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate
ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate (PubChem CID 6358502) has the molecular formula C7H14N2O4S
and a molecular weight of 222.27 g/mol. Its IUPAC name is ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate |
| PubChem CID | 6358502 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1N |
| InChI | InChI=1S/C7H14N2O4S/c1-2-13-7(10)9-6-4-14(11,12)3-5(6)8/h5-6H,2-4,8H2,1H3,(H,9,10)/t5-,6-/m1/s1 |
| InChIKey | ZHLPCTGYIDZBNJ-PHDIDXHHSA-N |
| XLogP | -1.14 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate?
The IUPAC name of ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate (CID 6358502) is ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate.
What is the SMILES notation for ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate?
The canonical SMILES for ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate is CCOC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1N.
What is the InChIKey of ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate?
The InChIKey is ZHLPCTGYIDZBNJ-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H14N2O4S/c1-2-13-7(10)9-6-4-14(11,12)3-5(6)8/h5-6H,2-4,8H2,1H3,(H,9,10)/t5-,6-/m1/s1.
What are the key properties of ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate?
ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate has a molecular weight of 222.27 g/mol, XLogP of -1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(3S,4S)-4-amino-1,1-dioxothiolan-3-yl]carbamate is sourced from PubChem (CID 6358502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).