C10H13F3N4O2 — CID 63585404
5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63585404) has the molecular formula C10H13F3N4O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is 5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63585404 |
| Molecular Formula | C10H13F3N4O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | NNC(=O)c1cc(CN(CC(F)(F)F)C2CC2)on1 |
| InChI | InChI=1S/C10H13F3N4O2/c11-10(12,13)5-17(6-1-2-6)4-7-3-8(16-19-7)9(18)15-14/h3,6H,1-2,4-5,14H2,(H,15,18) |
| InChIKey | FCLLYWBNMOEZGH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|