About 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide
2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide (PubChem CID 63585589) has the molecular formula C7H14F3N3O
and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide.
Molecular Properties
| Compound Name | 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide |
| PubChem CID | 63585589 |
| Molecular Formula | C7H14F3N3O |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide |
| SMILES | CCN(CC(F)(F)F)C(C)C(=O)NN |
| InChI | InChI=1S/C7H14F3N3O/c1-3-13(4-7(8,9)10)5(2)6(14)12-11/h5H,3-4,11H2,1-2H3,(H,12,14) |
| InChIKey | XCMWKSQJRZFSLS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide?
The IUPAC name of 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide (CID 63585589) is 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide.
What is the SMILES notation for 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide?
The canonical SMILES for 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide is CCN(CC(F)(F)F)C(C)C(=O)NN.
What is the InChIKey of 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide?
The InChIKey is XCMWKSQJRZFSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3N3O/c1-3-13(4-7(8,9)10)5(2)6(14)12-11/h5H,3-4,11H2,1-2H3,(H,12,14).
What are the key properties of 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide?
2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide has a molecular weight of 213.20 g/mol, XLogP of 0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(2,2,2-trifluoroethyl)amino]propanehydrazide is sourced from PubChem (CID 63585589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).