C10H17F3N6O — CID 63585597
1-[2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]triazole-4-carbohydrazide (PubChem CID 63585597) has the molecular formula C10H17F3N6O and a molecular weight of 294.28 g/mol. Its IUPAC name is 1-[2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63585597 |
| Molecular Formula | C10H17F3N6O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[2-[propyl(2,2,2-trifluoroethyl)amino]ethyl]triazole-4-carbohydrazide |
| SMILES | CCCN(CCn1cc(C(=O)NN)nn1)CC(F)(F)F |
| InChI | InChI=1S/C10H17F3N6O/c1-2-3-18(7-10(11,12)13)4-5-19-6-8(16-17-19)9(20)15-14/h6H,2-5,7,14H2,1H3,(H,15,20) |
| InChIKey | FNRVLGUXWFQROA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|