C10H15F3N4O2 — CID 63585598
5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63585598) has the molecular formula C10H15F3N4O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63585598 |
| Molecular Formula | C10H15F3N4O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | CCCN(Cc1cc(C(=O)NN)no1)CC(F)(F)F |
| InChI | InChI=1S/C10H15F3N4O2/c1-2-3-17(6-10(11,12)13)5-7-4-8(16-19-7)9(18)15-14/h4H,2-3,5-6,14H2,1H3,(H,15,18) |
| InChIKey | RGSCWJWJCZLBHB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|