About 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide
5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide (PubChem CID 63585841) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide |
| PubChem CID | 63585841 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide |
| SMILES | Cc1ccc(N(C)Cc2cc(C)c(C(=O)NN)o2)cc1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-4-6-12(7-5-10)18(3)9-13-8-11(2)14(20-13)15(19)17-16/h4-8H,9,16H2,1-3H3,(H,17,19) |
| InChIKey | PAACIBVDQVHACK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide?
The IUPAC name of 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide (CID 63585841) is 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide.
What is the SMILES notation for 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide?
The canonical SMILES for 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide is Cc1ccc(N(C)Cc2cc(C)c(C(=O)NN)o2)cc1.
What is the InChIKey of 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide?
The InChIKey is PAACIBVDQVHACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-10-4-6-12(7-5-10)18(3)9-13-8-11(2)14(20-13)15(19)17-16/h4-8H,9,16H2,1-3H3,(H,17,19).
What are the key properties of 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide?
5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide has a molecular weight of 273.34 g/mol, XLogP of 2.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(N,4-dimethylanilino)methyl]-3-methylfuran-2-carbohydrazide is sourced from PubChem (CID 63585841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).