C10H12ClN5 — CID 63586359
6-chloro-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridin-2-amine (PubChem CID 63586359) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 6-chloro-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 63586359 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-chloro-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridin-2-amine |
| SMILES | CC(Nc1cccc(Cl)n1)c1nncn1C |
| InChI | InChI=1S/C10H12ClN5/c1-7(10-15-12-6-16(10)2)13-9-5-3-4-8(11)14-9/h3-7H,1-2H3,(H,13,14) |
| InChIKey | QTHWOYUFBKFFNU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|