C13H20ClN3 — CID 63587094
N-(6-chloro-2-pyridinyl)-N'-cyclopentyl-N'-methylethane-1,2-diamine (PubChem CID 63587094) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-N'-cyclopentyl-N'-methylethane-1,2-diamine.
| Compound Name | N-(6-chloro-2-pyridinyl)-N'-cyclopentyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 63587094 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-N'-cyclopentyl-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNc1cccc(Cl)n1)C1CCCC1 |
| InChI | InChI=1S/C13H20ClN3/c1-17(11-5-2-3-6-11)10-9-15-13-8-4-7-12(14)16-13/h4,7-8,11H,2-3,5-6,9-10H2,1H3,(H,15,16) |
| InChIKey | WLCFKXQYUAEPPH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|