About 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide
5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide (PubChem CID 63587192) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide |
| PubChem CID | 63587192 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide |
| SMILES | COCc1cc(C(=O)NN)no1 |
| InChI | InChI=1S/C6H9N3O3/c1-11-3-4-2-5(9-12-4)6(10)8-7/h2H,3,7H2,1H3,(H,8,10) |
| InChIKey | BYDDYQOQZJZVQI-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide?
The IUPAC name of 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide (CID 63587192) is 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide.
What is the SMILES notation for 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide?
The canonical SMILES for 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide is COCc1cc(C(=O)NN)no1.
What is the InChIKey of 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide?
The InChIKey is BYDDYQOQZJZVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c1-11-3-4-2-5(9-12-4)6(10)8-7/h2H,3,7H2,1H3,(H,8,10).
What are the key properties of 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide?
5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide has a molecular weight of 171.16 g/mol, XLogP of -0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-1,2-oxazole-3-carbohydrazide is sourced from PubChem (CID 63587192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).