C13H19ClN2 — CID 63587269
6-chloro-N-(cyclohexylmethyl)-N-methylpyridin-2-amine (PubChem CID 63587269) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is 6-chloro-N-(cyclohexylmethyl)-N-methylpyridin-2-amine.
| Compound Name | 6-chloro-N-(cyclohexylmethyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 63587269 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 6-chloro-N-(cyclohexylmethyl)-N-methylpyridin-2-amine |
| SMILES | CN(CC1CCCCC1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C13H19ClN2/c1-16(10-11-6-3-2-4-7-11)13-9-5-8-12(14)15-13/h5,8-9,11H,2-4,6-7,10H2,1H3 |
| InChIKey | SPTUHLYECLSDCA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|