C15H24N2O — CID 63588884
2-[4-(aminomethyl)phenyl]-N-propan-2-yl-N-propylacetamide (PubChem CID 63588884) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-[4-(aminomethyl)phenyl]-N-propan-2-yl-N-propylacetamide.
| Compound Name | 2-[4-(aminomethyl)phenyl]-N-propan-2-yl-N-propylacetamide |
|---|---|
| PubChem CID | 63588884 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-[4-(aminomethyl)phenyl]-N-propan-2-yl-N-propylacetamide |
| SMILES | CCCN(C(=O)Cc1ccc(CN)cc1)C(C)C |
| InChI | InChI=1S/C15H24N2O/c1-4-9-17(12(2)3)15(18)10-13-5-7-14(11-16)8-6-13/h5-8,12H,4,9-11,16H2,1-3H3 |
| InChIKey | JXFBDFPJCMQDNI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |