C14H16N2O2 — CID 63589285
N-(3-cyanopropyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 63589285) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(3-cyanopropyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(3-cyanopropyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 63589285 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-(3-cyanopropyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | N#CCCCNC(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C14H16N2O2/c15-7-3-4-8-16-14(17)12-9-11-5-1-2-6-13(11)18-10-12/h1-2,5-6,12H,3-4,8-10H2,(H,16,17) |
| InChIKey | ZGVCCXBGFSGPDY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|