C10H10N2OS2 — CID 63590827
3-(sulfanylmethyl)-1-benzothiophene-2-carbohydrazide (PubChem CID 63590827) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is 3-(sulfanylmethyl)-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-(sulfanylmethyl)-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63590827 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 3-(sulfanylmethyl)-1-benzothiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sc2ccccc2c1CS |
| InChI | InChI=1S/C10H10N2OS2/c11-12-10(13)9-7(5-14)6-3-1-2-4-8(6)15-9/h1-4,14H,5,11H2,(H,12,13) |
| InChIKey | LZRJTMXZWXEULP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|