C12H18N2O2 — CID 63590971
[1-(6-methoxy-2-pyridinyl)piperidin-2-yl]methanol (PubChem CID 63590971) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is [1-(6-methoxy-2-pyridinyl)piperidin-2-yl]methanol.
| Compound Name | [1-(6-methoxy-2-pyridinyl)piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 63590971 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [1-(6-methoxy-2-pyridinyl)piperidin-2-yl]methanol |
| SMILES | COc1cccc(N2CCCCC2CO)n1 |
| InChI | InChI=1S/C12H18N2O2/c1-16-12-7-4-6-11(13-12)14-8-3-2-5-10(14)9-15/h4,6-7,10,15H,2-3,5,8-9H2,1H3 |
| InChIKey | CNZZFIJKYLEYMQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |