About 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline
5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 63591779) has the molecular formula C11H13FN4O
and a molecular weight of 236.25 g/mol. Its IUPAC name is 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline.
Molecular Properties
| Compound Name | 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline |
| PubChem CID | 63591779 |
| Molecular Formula | C11H13FN4O |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | CCCOc1cc(-n2cncn2)c(N)cc1F |
| InChI | InChI=1S/C11H13FN4O/c1-2-3-17-11-5-10(9(13)4-8(11)12)16-7-14-6-15-16/h4-7H,2-3,13H2,1H3 |
| InChIKey | SATQPBSUNMHFFJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline?
The IUPAC name of 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline (CID 63591779) is 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline.
What is the SMILES notation for 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline?
The canonical SMILES for 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline is CCCOc1cc(-n2cncn2)c(N)cc1F.
What is the InChIKey of 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline?
The InChIKey is SATQPBSUNMHFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN4O/c1-2-3-17-11-5-10(9(13)4-8(11)12)16-7-14-6-15-16/h4-7H,2-3,13H2,1H3.
What are the key properties of 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline?
5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline has a molecular weight of 236.25 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-propoxy-2-(1,2,4-triazol-1-yl)aniline is sourced from PubChem (CID 63591779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).