C14H19F3N2O2 — CID 63591935
[1-[2-amino-5-(difluoromethoxy)-4-fluoroanilino]cyclohexyl]methanol (PubChem CID 63591935) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is [1-[2-amino-5-(difluoromethoxy)-4-fluoroanilino]cyclohexyl]methanol.
| Compound Name | [1-[2-amino-5-(difluoromethoxy)-4-fluoroanilino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 63591935 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [1-[2-amino-5-(difluoromethoxy)-4-fluoroanilino]cyclohexyl]methanol |
| SMILES | Nc1cc(F)c(OC(F)F)cc1NC1(CO)CCCCC1 |
| InChI | InChI=1S/C14H19F3N2O2/c15-9-6-10(18)11(7-12(9)21-13(16)17)19-14(8-20)4-2-1-3-5-14/h6-7,13,19-20H,1-5,8,18H2 |
| InChIKey | SWBSXCSHTJCZEC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|