C12H14F6N2O — CID 63592611
4-(difluoromethoxy)-5-fluoro-2-N-propan-2-yl-2-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine (PubChem CID 63592611) has the molecular formula C12H14F6N2O and a molecular weight of 316.25 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-fluoro-2-N-propan-2-yl-2-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine.
| Compound Name | 4-(difluoromethoxy)-5-fluoro-2-N-propan-2-yl-2-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63592611 |
| Molecular Formula | C12H14F6N2O |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(difluoromethoxy)-5-fluoro-2-N-propan-2-yl-2-N-(2,2,2-trifluoroethyl)benzene-1,2-diamine |
| SMILES | CC(C)N(CC(F)(F)F)c1cc(OC(F)F)c(F)cc1N |
| InChI | InChI=1S/C12H14F6N2O/c1-6(2)20(5-12(16,17)18)9-4-10(21-11(14)15)7(13)3-8(9)19/h3-4,6,11H,5,19H2,1-2H3 |
| InChIKey | TYSWTXXBVQUDEH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|