C13H10F3IN2O — CID 63592922
4-(difluoromethoxy)-5-fluoro-2-N-(2-iodophenyl)benzene-1,2-diamine (PubChem CID 63592922) has the molecular formula C13H10F3IN2O and a molecular weight of 394.13 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-fluoro-2-N-(2-iodophenyl)benzene-1,2-diamine.
| Compound Name | 4-(difluoromethoxy)-5-fluoro-2-N-(2-iodophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63592922 |
| Molecular Formula | C13H10F3IN2O |
| Molecular Weight | 394.13 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 4-(difluoromethoxy)-5-fluoro-2-N-(2-iodophenyl)benzene-1,2-diamine |
| SMILES | Nc1cc(F)c(OC(F)F)cc1Nc1ccccc1I |
| InChI | InChI=1S/C13H10F3IN2O/c14-7-5-9(18)11(6-12(7)20-13(15)16)19-10-4-2-1-3-8(10)17/h1-6,13,19H,18H2 |
| InChIKey | JYGWPBOTEUDVMB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.13 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|