C15H24FN3O2 — CID 63593047
4-ethoxy-5-fluoro-2-N-(1-morpholin-4-ylpropan-2-yl)benzene-1,2-diamine (PubChem CID 63593047) has the molecular formula C15H24FN3O2 and a molecular weight of 297.37 g/mol. Its IUPAC name is 4-ethoxy-5-fluoro-2-N-(1-morpholin-4-ylpropan-2-yl)benzene-1,2-diamine.
| Compound Name | 4-ethoxy-5-fluoro-2-N-(1-morpholin-4-ylpropan-2-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63593047 |
| Molecular Formula | C15H24FN3O2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-ethoxy-5-fluoro-2-N-(1-morpholin-4-ylpropan-2-yl)benzene-1,2-diamine |
| SMILES | CCOc1cc(NC(C)CN2CCOCC2)c(N)cc1F |
| InChI | InChI=1S/C15H24FN3O2/c1-3-21-15-9-14(13(17)8-12(15)16)18-11(2)10-19-4-6-20-7-5-19/h8-9,11,18H,3-7,10,17H2,1-2H3 |
| InChIKey | LKFZNJYWPDRHIX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|