C17H21FN2O — CID 63594129
2-N-(2,4-dimethylphenyl)-4-ethoxy-5-fluoro-2-N-methylbenzene-1,2-diamine (PubChem CID 63594129) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-N-(2,4-dimethylphenyl)-4-ethoxy-5-fluoro-2-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(2,4-dimethylphenyl)-4-ethoxy-5-fluoro-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 63594129 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-N-(2,4-dimethylphenyl)-4-ethoxy-5-fluoro-2-N-methylbenzene-1,2-diamine |
| SMILES | CCOc1cc(N(C)c2ccc(C)cc2C)c(N)cc1F |
| InChI | InChI=1S/C17H21FN2O/c1-5-21-17-10-16(14(19)9-13(17)18)20(4)15-7-6-11(2)8-12(15)3/h6-10H,5,19H2,1-4H3 |
| InChIKey | QEHHTJQHECJUNM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|