C15H28N4O2 — CID 63594840
1-(4-acetylpiperazin-1-yl)-2-[4-(1-aminoethyl)piperidin-1-yl]ethanone (PubChem CID 63594840) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-[4-(1-aminoethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-[4-(1-aminoethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 63594840 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-[4-(1-aminoethyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)CN2CCC(C(C)N)CC2)CC1 |
| InChI | InChI=1S/C15H28N4O2/c1-12(16)14-3-5-17(6-4-14)11-15(21)19-9-7-18(8-10-19)13(2)20/h12,14H,3-11,16H2,1-2H3 |
| InChIKey | OWOYOGWCKMBNKS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |