C12H15Cl2N3O — CID 63595115
4-[(3,6-dichloro-2-pyridinyl)methyl]-3,3-dimethylpiperazin-2-one (PubChem CID 63595115) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is 4-[(3,6-dichloro-2-pyridinyl)methyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[(3,6-dichloro-2-pyridinyl)methyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63595115 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-[(3,6-dichloro-2-pyridinyl)methyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1Cc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H15Cl2N3O/c1-12(2)11(18)15-5-6-17(12)7-9-8(13)3-4-10(14)16-9/h3-4H,5-7H2,1-2H3,(H,15,18) |
| InChIKey | RLHXGSGCQIIRRP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|