C15H22ClN3O — CID 63595749
4-[2-amino-1-(2-chlorophenyl)propyl]-3,3-dimethylpiperazin-2-one (PubChem CID 63595749) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is 4-[2-amino-1-(2-chlorophenyl)propyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[2-amino-1-(2-chlorophenyl)propyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63595749 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 4-[2-amino-1-(2-chlorophenyl)propyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC(N)C(c1ccccc1Cl)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C15H22ClN3O/c1-10(17)13(11-6-4-5-7-12(11)16)19-9-8-18-14(20)15(19,2)3/h4-7,10,13H,8-9,17H2,1-3H3,(H,18,20) |
| InChIKey | VLYFEBNQRVNUMQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |