About 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline
4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline (PubChem CID 63595811) has the molecular formula C13H12F3N3OS
and a molecular weight of 315.32 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline |
| PubChem CID | 63595811 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline |
| SMILES | Cc1cc(C)nc(Sc2cc(OC(F)F)c(F)cc2N)n1 |
| InChI | InChI=1S/C13H12F3N3OS/c1-6-3-7(2)19-13(18-6)21-11-5-10(20-12(15)16)8(14)4-9(11)17/h3-5,12H,17H2,1-2H3 |
| InChIKey | AQWNAAHKGOPSNU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline?
The IUPAC name of 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline (CID 63595811) is 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline.
What is the SMILES notation for 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline?
The canonical SMILES for 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline is Cc1cc(C)nc(Sc2cc(OC(F)F)c(F)cc2N)n1.
What is the InChIKey of 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline?
The InChIKey is AQWNAAHKGOPSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N3OS/c1-6-3-7(2)19-13(18-6)21-11-5-10(20-12(15)16)8(14)4-9(11)17/h3-5,12H,17H2,1-2H3.
What are the key properties of 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline?
4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline has a molecular weight of 315.32 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoroaniline is sourced from PubChem (CID 63595811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).